* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SOYASAPOGENOL B |
| CAS: | 595-15-3 |
| English Synonyms: | SOYASAPOGENOL B |
| MDL Number.: | MFCD00075988 |
| H bond acceptor: | 3 |
| H bond donor: | 3 |
| Smile: | CC1(C[C@H]2C3=CC[C@@H]4[C@]5(CC[C@@H]([C@]([C@@H]5CC[C@]4([C@@]3(CC[C@]2([C@@H](C1)O)C)C)C)(C)CO)O)C)C |
| InChi: | InChI=1S/C30H50O3/c1-25(2)16-20-19-8-9-22-27(4)12-11-23(32)28(5,18-31)21(27)10-13-30(22,7)29(19,6)15-14-26(20,3)24(33)17-25/h8,20-24,31-33H,9-18H2,1-7H3/t20-,21+,22+,23-,24+,26+,27-,28+,29+,30+/m0/s1 |
| InChiKey: | InChIKey=YOQAQNKGFOLRGT-UXXABWCISA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.