* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-AMINO-4H-CHROMEN-4-ONE |
CAS: | 59507-94-7 |
English Synonyms: | 3-AMINO-4H-1-BENZOPYRAN-4-ONE ; 3-AMINO-4H-CHROMEN-4-ONE |
MDL Number.: | MFCD17926183 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(=O)c(co2)N |
InChi: | InChI=1S/C9H7NO2/c10-7-5-12-8-4-2-1-3-6(8)9(7)11/h1-5H,10H2 |
InChiKey: | InChIKey=KHHXAUPSBBQGKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.