* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2,2'-DIMETHYL-4,4'-BIPHENYLDIOL |
CAS: | 59517-19-0 |
English Synonyms: | 2,2'-DIMETHYL-4,4'-BIPHENYLDIOL ; 2,2'-DIMETHYL-[1,1'-BIPHENYL]-4,4'-DIOL |
MDL Number.: | MFCD00155173 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | Cc1cc(ccc1c2ccc(cc2C)O)O |
InChi: | InChI=1S/C14H14O2/c1-9-7-11(15)3-5-13(9)14-6-4-12(16)8-10(14)2/h3-8,15-16H,1-2H3 |
InChiKey: | InChIKey=GTFQLBWTUKSJQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.