* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-ILE-ASN-OH |
CAS: | 59652-59-4 |
English Synonyms: | ILE-ASN ; H-ILE-ASN-OH |
MDL Number.: | MFCD00057938 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CC[C@H](C)[C@@H](C(=O)N[C@@H](CC(=O)N)C(=O)O)N |
InChi: | InChI=1S/C10H19N3O4/c1-3-5(2)8(12)9(15)13-6(10(16)17)4-7(11)14/h5-6,8H,3-4,12H2,1-2H3,(H2,11,14)(H,13,15)(H,16,17)/t5-,6-,8-/m0/s1 |
InChiKey: | InChIKey=HZYHBDVRCBDJJV-HAFWLYHUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.