* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ENTEROCIN |
CAS: | 59678-46-5 |
English Synonyms: | VULGAMYCIN ; ENTEROCIN |
MDL Number.: | MFCD01714909 |
H bond acceptor: | 10 |
H bond donor: | 4 |
Smile: | COc1cc(oc(=O)c1)[C@@H]2[C@@]3(C[C@@H]4[C@H]([C@]2([C@@H]([C@]3(C(=O)O4)O)C(=O)c5ccccc5)O)O)O |
InChi: | InChI=1S/C22H20O10/c1-30-11-7-12(31-14(23)8-11)16-20(27)9-13-18(25)21(16,28)17(22(20,29)19(26)32-13)15(24)10-5-3-2-4-6-10/h2-8,13,16-18,25,27-29H,9H2,1H3/t13-,16-,17+,18-,20-,21+,22-/m1/s1 |
InChiKey: | InChIKey=CTBBEXWJRAPJIZ-VHPBLNRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.