* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,7-DIMETHOXY-3-METHYL-2,3-DIHYDRO-1H-INDEN-1-ONE |
CAS: | 59743-67-8 |
English Synonyms: | 4,7-DIMETHOXY-3-METHYL-2,3-DIHYDRO-1H-INDEN-1-ONE |
MDL Number.: | MFCD18072923 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC1CC(=O)c2c1c(ccc2OC)OC |
InChi: | InChI=1S/C12H14O3/c1-7-6-8(13)12-10(15-3)5-4-9(14-2)11(7)12/h4-5,7H,6H2,1-3H3 |
InChiKey: | InChIKey=SUEAWVWSLMANOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.