* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,3,4,6,10B-HEXAHYDRO-10B-PHENYLPYRIMIDO(2,1-A)ISOINDOL-6-ONE |
CAS: | 5983-52-8 |
English Synonyms: | BUTTPARK 39\07-98 ; 1,2,3,4,6,10B-HEXAHYDRO-10B-PHENYLPYRIMIDO(2,1-A)ISOINDOL-6-ONE |
MDL Number.: | MFCD00033410 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)C23c4ccccc4C(=O)N2CCCN3 |
InChi: | InChI=1S/C17H16N2O/c20-16-14-9-4-5-10-15(14)17(13-7-2-1-3-8-13)18-11-6-12-19(16)17/h1-5,7-10,18H,6,11-12H2 |
InChiKey: | InChIKey=PJMQDIXGYNLHIK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.