* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLABROL |
| CAS: | 59870-65-4 |
| English Synonyms: | GLABROL |
| MDL Number.: | MFCD07779164 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(=CCc1cc(ccc1O)[C@@H]2CC(=O)c3ccc(c(c3O2)CC=C(C)C)O)C |
| InChi: | InChI=1S/C25H28O4/c1-15(2)5-7-17-13-18(8-11-21(17)26)24-14-23(28)20-10-12-22(27)19(25(20)29-24)9-6-16(3)4/h5-6,8,10-13,24,26-27H,7,9,14H2,1-4H3/t24-/m0/s1 |
| InChiKey: | InChIKey=CUFAXDWQDQQKFF-DEOSSOPVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.