* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | N-FORMYL-MET-PHE-MET |
CAS: | 59881-02-6 |
English Synonyms: | N-FORMYL-MET-PHE-MET |
MDL Number.: | MFCD00038675 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | CSCC[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCSC)C(=O)O)NC=O |
InChi: | InChI=1S/C20H29N3O5S2/c1-29-10-8-15(21-13-24)18(25)23-17(12-14-6-4-3-5-7-14)19(26)22-16(20(27)28)9-11-30-2/h3-7,13,15-17H,8-12H2,1-2H3,(H,21,24)(H,22,26)(H,23,25)(H,27,28)/t15-,16-,17-/m0/s1 |
InChiKey: | InChIKey=BSSXRCLBQLQBOD-ULQDDVLXSA-N |
|
|
|
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.