Molecular Structure:
CAS No.:
59892-90-9
Product Name.:
CCD No.:CCD00065673
Formula:C6 H10 O5 T2
MolWeight:168.172
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | L-FUCOSE-(5,6-3H) |
| CAS： | 59892-90-9 |
| English Synonyms： | L-FUCOSE-(5,6-3H) |
| MDL Number.： | MFCD00135792 |
| H bond acceptor： | 5 |
| H bond donor： | 4 |
| Smile： | [3H]C[C@]1([C@H]([C@H]([C@@H](C(O1)O)O)O)O)[3H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
