* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-NITROBUTANE |
CAS: | 600-24-8 |
English Synonyms: | 2-NITROBUTANE |
MDL Number.: | MFCD00047759 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCC(C)[N+](=O)[O-] |
InChi: | InChI=1S/C4H9NO2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3 |
InChiKey: | InChIKey=SUGZATOHBPXTDV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.