* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BRAZILEIN |
CAS: | 600-76-0 |
English Synonyms: | BRAZILEIN |
MDL Number.: | MFCD11040815 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1cc2c(cc1O)OCC3(C2=C4C=C(C(=O)C=C4C3)O)O |
InChi: | InChI=1S/C16H12O5/c17-9-1-2-10-14(4-9)21-7-16(20)6-8-3-12(18)13(19)5-11(8)15(10)16/h1-5,17,19-20H,6-7H2 |
InChiKey: | InChIKey=MLWIYODOURBGPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.