* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (-)-YENHUSOMIDINE |
| CAS: | 56435-44-0 ;60102-30-9 |
| English Synonyms: | (-)-YENHUSOMIDINE |
| MDL Number.: | MFCD00238708 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CN1CCc2cc(c(cc2[C@@]13[C@H](c4c(ccc5c4OCO5)C3=O)O)OC)OC |
| InChi: | InChI=1S/C21H21NO6/c1-22-7-6-11-8-15(25-2)16(26-3)9-13(11)21(22)19(23)12-4-5-14-18(28-10-27-14)17(12)20(21)24/h4-5,8-9,20,24H,6-7,10H2,1-3H3/t20-,21+/m0/s1 |
| InChiKey: | InChIKey=CSJAPFGQQAVKGU-LEWJYISDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.