* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DOPAMINE-8-14C HYDROCHLORIDE |
| CAS: | 60109-35-5 |
| English Synonyms: | DOPAMINE-8-14C HYDROCHLORIDE |
| MDL Number.: | MFCD16876053 |
| H bond acceptor: | 3 |
| H bond donor: | 3 |
| Smile: | c1[14cH][14c]([14c]([14cH][14c]1[14CH2][14CH2]N)O)O.Cl |
| InChi: | InChI=1S/C8H11NO2.ClH/c9-4-3-6-1-2-7(10)8(11)5-6;/h1-2,5,10-11H,3-4,9H2;1H/i2+2,3+2,4+2,5+2,6+2,7+2,8+2; |
| InChiKey: | InChIKey=CTENFNNZBMHDDG-BGGGVXOKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.