* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9,10-DIMETHYLPHENANTHRENE |
| CAS: | 604-83-1 |
| English Synonyms: | 9,10-DMP ; 9,10-DIMETHYLPHENANTHRENE |
| MDL Number.: | MFCD00215908 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | Cc1c(c2ccccc2c3c1cccc3)C |
| InChi: | InChI=1S/C16H14/c1-11-12(2)14-8-4-6-10-16(14)15-9-5-3-7-13(11)15/h3-10H,1-2H3 |
| InChiKey: | InChIKey=JUEORGSHIXFSSI-UHFFFAOYSA-N |
|
|
| Specification: | STANDARD |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.