* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3BETA-HYDROXY-20-OXO-29-NORLUP-20(29)-ENE-28-OIC ACID |
| CAS: | 6060-06-6 |
| English Synonyms: | PLATANIC ACID ; 3BETA-HYDROXY-20-OXO-29-NORLUP-20(29)-ENE-28-OIC ACID |
| MDL Number.: | MFCD16876116 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(=O)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)C(=O)O |
| InChi: | InChI=1S/C29H46O4/c1-17(30)18-9-14-29(24(32)33)16-15-27(5)19(23(18)29)7-8-21-26(4)12-11-22(31)25(2,3)20(26)10-13-28(21,27)6/h18-23,31H,7-16H2,1-6H3,(H,32,33)/t18-,19+,20-,21+,22-,23+,26-,27+,28+,29-/m0/s1 |
| InChiKey: | InChIKey=RVMPLOSJMIQORE-FUAAEJBOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.