* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-OXONONANOIC ACID |
| CAS: | 6064-52-4 |
| English Synonyms: | 4-OXONONANOIC ACID |
| MDL Number.: | MFCD00138072 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCCC(=O)CCC(=O)O |
| InChi: | InChI=1S/C9H16O3/c1-2-3-4-5-8(10)6-7-9(11)12/h2-7H2,1H3,(H,11,12) |
| InChiKey: | InChIKey=PRDIIROHTWNJDB-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.