* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRROLO[1',2':3,4]PYRIMIDO[2,1,6-CD]PYRROLIZINE |
CAS: | 60645-04-7 |
English Synonyms: | PYRROLO[1',2':3,4]PYRIMIDO[2,1,6-CD]PYRROLIZINE |
MDL Number.: | MFCD13183841 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc2cc3ccc4n3c(n2c1)cc4 |
InChi: | InChI=1S/C12H8N2/c1-2-10-8-11-4-3-9-5-6-12(14(9)11)13(10)7-1/h1-8H |
InChiKey: | InChIKey=ZZGQVJGBZLAGDR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.