* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | THIENO[3,2-B]THIOPHENE-2,5-DIONE |
| CAS: | 60749-71-5 |
| English Synonyms: | 2H,5H-THIENO[3,2-B]THIOPHENE-2,5-DIONE ; THIENO[3,2-B]THIOPHENE-2,5-DIONE |
| MDL Number.: | MFCD17012093 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C1=C2C(=CC(=O)S2)SC1=O |
| InChi: | InChI=1S/C6H2O2S2/c7-5-1-3-4(10-5)2-6(8)9-3/h1-2H |
| InChiKey: | InChIKey=JJFFKSNSZYHZPV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.