* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,3,4,4A,5,6,7-OCTAHYDRO-1,8-NAPHTHYRIDINE |
CAS: | 60832-40-8 |
English Synonyms: | 1,8-NAPHTHYRIDINE, 1,2,3,4,4A,5,6,7-OCTAHYDRO- ; 1,2,3,4,4A,5,6,7-OCTAHYDRO-1,8-NAPHTHYRIDINE |
MDL Number.: | MFCD13176235 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1CC2CCCN=C2NC1 |
InChi: | InChI=1S/C8H14N2/c1-3-7-4-2-6-10-8(7)9-5-1/h7H,1-6H2,(H,9,10) |
InChiKey: | InChIKey=ZILBOLGGDPHJSW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.