* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-IMIDAZOLE, 2-(2'-METHYL[1,1'-BIPHENYL]-2-YL)- |
CAS: | 608515-27-1 |
English Synonyms: | 1H-IMIDAZOLE, 2-(2'-METHYL[1,1'-BIPHENYL]-2-YL)- ; 2-(2'-METHYL[1,1'-BIPHENYL]-2-YL)-1H-IMIDAZOLE |
MDL Number.: | MFCD13183243 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1ccccc1c2ccccc2c3[nH]ccn3 |
InChi: | InChI=1S/C16H14N2/c1-12-6-2-3-7-13(12)14-8-4-5-9-15(14)16-17-10-11-18-16/h2-11H,1H3,(H,17,18) |
InChiKey: | InChIKey=DBTLJUJZQCPOSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.