* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-BENZYLPYRIDAZINE |
CAS: | 60905-93-3 |
English Synonyms: | 3-BENZYLPYRIDAZINE |
MDL Number.: | MFCD16657477 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)Cc2cccnn2 |
InChi: | InChI=1S/C11H10N2/c1-2-5-10(6-3-1)9-11-7-4-8-12-13-11/h1-8H,9H2 |
InChiKey: | InChIKey=VSAGNNLBESKHMW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.