* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6,6-DIMETHYL-4,8-DIOXASPIRO[2.5]OCT-1-ENE |
CAS: | 60935-22-0 |
English Synonyms: | 6,6-DIMETHYL-4,8-DIOXASPIRO[2.5]OCT-1-ENE |
MDL Number.: | MFCD17013518 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC1(COC2(C=C2)OC1)C |
InChi: | InChI=1S/C8H12O2/c1-7(2)5-9-8(3-4-8)10-6-7/h3-4H,5-6H2,1-2H3 |
InChiKey: | InChIKey=AINMINDCBBSFAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.