* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (7E)-1,4,5,6-TETRAHYDRO-1-METHYL-7H-INDOL-7-ONE OXIME |
CAS: | 609368-68-5 ;609368-67-4 |
English Synonyms: | (7Z)-1,4,5,6-TETRAHYDRO-1-METHYL-7H-INDOL-7-ONE OXIME ; (7E)-1,4,5,6-TETRAHYDRO-1-METHYL-7H-INDOL-7-ONE OXIME |
MDL Number.: | MFCD12924539 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cn1ccc2c1/C(=N\O)/CCC2 |
InChi: | InChI=1S/C9H12N2O/c1-11-6-5-7-3-2-4-8(10-12)9(7)11/h5-6,12H,2-4H2,1H3/b10-8- |
InChiKey: | InChIKey=TVRNFPOPASDEST-NTMALXAHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.