* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (7E)-1,4,5,6-TETRAHYDRO-7H-INDOL-7-ONE OXIME |
CAS: | 609368-70-9 ;609368-69-6 |
English Synonyms: | (7E)-1,4,5,6-TETRAHYDRO-7H-INDOL-7-ONE OXIME ; (7Z)-7H-INDOL-7-ONE, 1,4,5,6-TETRAHYDRO-, OXIME |
MDL Number.: | MFCD12923945 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1c[nH]c\2c1CCC/C2=N/O |
InChi: | InChI=1S/C8H10N2O/c11-10-7-3-1-2-6-4-5-9-8(6)7/h4-5,9,11H,1-3H2/b10-7- |
InChiKey: | InChIKey=KCTSDNCEUHTCCY-YFHOEESVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.