* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (R,S)-CAMPHOS |
CAS: | 60989-76-6 |
English Synonyms: | (R,S)-CAMPHOS |
MDL Number.: | MFCD16876569 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1([C@H](CC[C@@]1(C)CP(c2ccccc2)c3ccccc3)CP(c4ccccc4)c5ccccc5)C |
InChi: | InChI=1S/C34H38P2/c1-33(2)28(26-35(29-16-8-4-9-17-29)30-18-10-5-11-19-30)24-25-34(33,3)27-36(31-20-12-6-13-21-31)32-22-14-7-15-23-32/h4-23,28H,24-27H2,1-3H3/t28-,34+/m1/s1 |
InChiKey: | InChIKey=RQRQLRNRSXOZPL-MYVCOICNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.