* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHYLQUINOLINE |
CAS: | 611-32-5 ;1199266-77-7 |
English Synonyms: | O-TOLUQUINOLINE ; 8-METHYLQUINOLINE |
MDL Number.: | MFCD00006810 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cc1cccc2c1nccc2 |
InChi: | InChI=1S/C10H9N/c1-8-4-2-5-9-6-3-7-11-10(8)9/h2-7H,1H3 |
InChiKey: | InChIKey=JRLTTZUODKEYDH-UHFFFAOYSA-N |
Property |
|
Melting Point: | -80 DEG C(LIT)/-80 °C |
Boiling Point: | 143 DEG C/34 MMHG(LIT)/248 °C |
Density: | DENSITY: 1.052 G/ML AT 25 DEG C(LIT) |
Physical Property: | FLASHPOINT: 105 DEG C FLASHPOINT: 221 DEG F REFRACTIVE INDEX: N20/D 1.614(LIT) |
Comments: | RTECS: VC0562000 UNSPSC: 12352100 WGK: 3 |
Safety information |
|
Symbol: | GHS07 |
Signal word: | Warning |
Hazard statements: | H315-H319-H335 |
Precautionary statements: | P261-P305 + P351 + P338 |
hazard symbol: | Xi |
Risk Code: | R:36/37/38 |
Safe Code: | S:26-36 |
WGK Germany: | 3 |
Flash point: | 105 °C |
* If the product has intellectual property rights, a license granted is must or contact us.