* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,5,6,7-TETRAHYDRO-ISOXAZOLO[4,3-C]PYRIDIN-3-AMINE |
CAS: | 61112-00-3 |
English Synonyms: | 4,5,6,7-TETRAHYDRO-ISOXAZOLO[4,3-C]PYRIDIN-3-AMINE |
MDL Number.: | MFCD13178804 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C1CNCc2c1noc2N |
InChi: | InChI=1S/C6H9N3O/c7-6-4-3-8-2-1-5(4)9-10-6/h8H,1-3,7H2 |
InChiKey: | InChIKey=BMRJCVVNLHTLTB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.