* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PIPERAZINE, 3-METHYL-1-(TRIFLUOROACETYL)-, (3S)- |
| CAS: | 612493-84-2 |
| English Synonyms: | PIPERAZINE, 3-METHYL-1-(TRIFLUOROACETYL)-, (3S)- |
| MDL Number.: | MFCD13172853 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C[C@H]1CN(CCN1)C(=O)C(F)(F)F |
| InChi: | InChI=1S/C7H11F3N2O/c1-5-4-12(3-2-11-5)6(13)7(8,9)10/h5,11H,2-4H2,1H3/t5-/m0/s1 |
| InChiKey: | InChIKey=ZIVGBPIRQIVVAJ-YFKPBYRVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.