* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRIDO[3,2-E]-1,2,4-TRIAZINE |
CAS: | 6133-44-4 |
English Synonyms: | PYRIDO[3,2-E]-1,2,4-TRIAZINE |
MDL Number.: | MFCD13175875 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc2c(nc1)nncn2 |
InChi: | InChI=1S/C6H4N4/c1-2-5-6(7-3-1)10-9-4-8-5/h1-4H |
InChiKey: | InChIKey=GUODQFHMIYUCLH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.