* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (7R)-5-METHYL-2,5,19-TRIAZATETRACYCLO[13.4.0.0(2,7).0(8,13)]NONADECA-1(15),8(13),9,11,16,18-HEXAENE |
CAS: | 61364-37-2 |
English Synonyms: | (7R)-5-METHYL-2,5,19-TRIAZATETRACYCLO[13.4.0.0(2,7).0(8,13)]NONADECA-1(15),8(13),9,11,16,18-HEXAENE |
MDL Number.: | MFCD11501593 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CN1CCN2c3c(cccn3)Cc4ccccc4[C@@H]2C1 |
InChi: | InChI=1S/C17H19N3/c1-19-9-10-20-16(12-19)15-7-3-2-5-13(15)11-14-6-4-8-18-17(14)20/h2-8,16H,9-12H2,1H3/t16-/m0/s1 |
InChiKey: | InChIKey=RONZAEMNMFQXRA-INIZCTEOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.