* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHOASCIN |
| CAS: | 61391-08-0 |
| English Synonyms: | XANTHOASCIN |
| MDL Number.: | MFCD01707564 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC1(CCc2cc(ccc2O1)/C=C(\C(=C/c3ccc(cc3)O)\[N+]#[C-])/[N+]#[C-])C |
| InChi: | InChI=1S/C23H20N2O2/c1-23(2)12-11-18-13-17(7-10-22(18)27-23)15-21(25-4)20(24-3)14-16-5-8-19(26)9-6-16/h5-10,13-15,26H,11-12H2,1-2H3/b20-14+,21-15+ |
| InChiKey: | InChIKey=ONZXHWTZPHRYLC-OZNQKUEASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.