* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3R)-1-ETHYL-3-HYDROXY-2-PIPERIDINONE |
CAS: | 614754-31-3 |
English Synonyms: | (3R)-1-ETHYL-3-HYDROXY-2-PIPERIDINONE |
MDL Number.: | MFCD13178914 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCN1CCC[C@H](C1=O)O |
InChi: | InChI=1S/C7H13NO2/c1-2-8-5-3-4-6(9)7(8)10/h6,9H,2-5H2,1H3/t6-/m1/s1 |
InChiKey: | InChIKey=QPLQVGGWWHQYNV-ZCFIWIBFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.