* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3S)-3-(ACETYLOXY)-1-METHYL-2-PIPERIDINONE |
CAS: | 614754-33-5 |
English Synonyms: | (3S)-3-(ACETYLOXY)-1-METHYL-2-PIPERIDINONE |
MDL Number.: | MFCD13179424 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(=O)O[C@H]1CCCN(C1=O)C |
InChi: | InChI=1S/C8H13NO3/c1-6(10)12-7-4-3-5-9(2)8(7)11/h7H,3-5H2,1-2H3/t7-/m0/s1 |
InChiKey: | InChIKey=CTIDCKRODJEIQE-ZETCQYMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.