* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-ASP-OH |
| CAS: | 6154-38-7 |
| English Synonyms: | Z-GLYCYL-L-ASPARTIC ACID ; Z-GLY-ASP-OH |
| MDL Number.: | MFCD00037284 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | c1ccc(cc1)COC(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChi: | InChI=1S/C14H16N2O7/c17-11(16-10(13(20)21)6-12(18)19)7-15-14(22)23-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,15,22)(H,16,17)(H,18,19)(H,20,21)/t10-/m0/s1 |
| InChiKey: | InChIKey=WINDTKMAFAXPSY-JTQLQIEISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.