* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | PENTANE-3-THIOL |
CAS: | 616-31-9 |
English Synonyms: | 3-PENTANETHIOL ; PENTANE-3-THIOL |
MDL Number.: | MFCD11193802 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCC(CC)S |
InChi: | InChI=1S/C5H12S/c1-3-5(6)4-2/h5-6H,3-4H2,1-2H3 |
InChiKey: | InChIKey=WICKAMSPKJXSGN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.