* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(1-METHYL-1H-INDOL-5-YL)ETHANONE |
CAS: | 61640-20-8 |
English Synonyms: | 1-(1-METHYL-1H-INDOL-5-YL)ETHANONE |
MDL Number.: | MFCD13178530 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(=O)c1ccc2c(c1)ccn2C |
InChi: | InChI=1S/C11H11NO/c1-8(13)9-3-4-11-10(7-9)5-6-12(11)2/h3-7H,1-2H3 |
InChiKey: | InChIKey=XQQNYKROVSVLHR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.