* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-METHYL-5-HEXEN-2-ONE |
CAS: | 61675-14-7 |
English Synonyms: | 5-HEXEN-2-ONE, 4-METHYL- ; 4-METHYLHEX-5-EN-2-ONE ; 4-METHYL-5-HEXEN-2-ONE |
MDL Number.: | MFCD16745044 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(CC(=O)C)C=C |
InChi: | InChI=1S/C7H12O/c1-4-6(2)5-7(3)8/h4,6H,1,5H2,2-3H3 |
InChiKey: | InChIKey=MXGGBUKCVFGCAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.