* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-ANTHRYLOXIRANE |
CAS: | 61695-73-6 |
English Synonyms: | 9-ANTHRYLOXIRANE |
MDL Number.: | MFCD01675047 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)cc3ccccc3c2C4CO4 |
InChi: | InChI=1S/C16H12O/c1-3-7-13-11(5-1)9-12-6-2-4-8-14(12)16(13)15-10-17-15/h1-9,15H,10H2 |
InChiKey: | InChIKey=WSQHNGOQXGWRRF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.