* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,4,5-TRIBROMOBENZOIC ACID |
CAS: | 618-74-6 |
English Synonyms: | 3,4,5-TRIBROMOBENZOIC ACID |
MDL Number.: | MFCD00075794 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c(cc(c(c1Br)Br)Br)C(=O)O |
InChi: | InChI=1S/C7H3Br3O2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,(H,11,12) |
InChiKey: | InChIKey=UDZOUVAHFWHQEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.