* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-PRO-PHE-PRO-LEU-OH |
| CAS: | 61867-13-8 |
| English Synonyms: | Z-GLY-PRO-PHE-PRO-LEU-OH |
| MDL Number.: | MFCD00133584 |
| H bond acceptor: | 13 |
| H bond donor: | 4 |
| Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]3CCCN3C(=O)CNC(=O)OCc4ccccc4 |
| InChi: | InChI=1S/C35H45N5O8/c1-23(2)19-27(34(45)46)38-32(43)29-16-10-18-40(29)33(44)26(20-24-11-5-3-6-12-24)37-31(42)28-15-9-17-39(28)30(41)21-36-35(47)48-22-25-13-7-4-8-14-25/h3-8,11-14,23,26-29H,9-10,15-22H2,1-2H3,(H,36,47)(H,37,42)(H,38,43)(H,45,46)/t26-,27-,28-,29-/m0/s1 |
| InChiKey: | InChIKey=CKNVGZIRPDUFOZ-DZUOILHNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.