* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2(1H)-PYRIDINONE, 6-ETHYL- |
CAS: | 61892-99-7 |
English Synonyms: | 2(1H)-PYRIDINONE, 6-ETHYL- ; 6-ETHYL-2(1H)-PYRIDINONE ; 6-ETHYL-1H-PYRIDIN-2-ONE |
MDL Number.: | MFCD13175370 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCc1cccc(=O)[nH]1 |
InChi: | InChI=1S/C7H9NO/c1-2-6-4-3-5-7(9)8-6/h3-5H,2H2,1H3,(H,8,9) |
InChiKey: | InChIKey=ILQXAOKYVNWFKK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.