* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IMPERIALONE |
| CAS: | 61989-75-1 |
| English Synonyms: | IMPERIALONE |
| MDL Number.: | MFCD00236482 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C[C@H]1CC[C@H]2[C@]([C@@H]3CC[C@@H]4[C@H]([C@@H]3CN2C1)C[C@H]5[C@H]4CC(=O)[C@@H]6[C@@]5(CCC(=O)C6)C)(C)O |
| InChi: | InChI=1S/C27H41NO3/c1-15-4-7-25-27(3,31)21-6-5-17-18(20(21)14-28(25)13-15)11-22-19(17)12-24(30)23-10-16(29)8-9-26(22,23)2/h15,17-23,25,31H,4-14H2,1-3H3/t15-,17+,18+,19-,20-,21+,22-,23+,25-,26+,27+/m0/s1 |
| InChiKey: | InChIKey=HIDAYMRWVVNXAO-GIYMPXGUSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.