* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-CHLORO-4-METHYLPENTANE |
| CAS: | 62016-94-8 |
| English Synonyms: | 1-CHLORO-4-METHYLPENTANE |
| MDL Number.: | MFCD00045304 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CC(C)CCCCl |
| InChi: | InChI=1S/C6H13Cl/c1-6(2)4-3-5-7/h6H,3-5H2,1-2H3 |
| InChiKey: | InChIKey=QUKRJOOWAUJXJN-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.