* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-([1,1'-BIPHENYL]-4-YL)-1,3,4-OXADIAZOL-2-AMINE |
CAS: | 62035-97-6 |
English Synonyms: | 5-([1,1'-BIPHENYL]-4-YL)-1,3,4-OXADIAZOL-2-AMINE ; 5-BIPHENYL-4-YL-1,3,4-OXADIAZOL-2-AMINE |
MDL Number.: | MFCD16652957 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2ccc(cc2)c3nnc(o3)N |
InChi: | InChI=1S/C14H11N3O/c15-14-17-16-13(18-14)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H2,15,17) |
InChiKey: | InChIKey=LSVVDJZSJUIFHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.