* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-AMINO-4-IMINORIFAMYCIN-S |
| CAS: | 62041-01-4 |
| English Synonyms: | 3-AMINO-4-IMINORIFAMYCIN-S |
| MDL Number.: | MFCD09954181 |
| H bond acceptor: | 14 |
| H bond donor: | 6 |
| Smile: | Cc1c(c2c3c4c1O[C@@](C4=O)(O/C=C/[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]([C@H](/C=C/C=C(\C(=O)NC(=C(C3=N)N)C2=O)/C)C)O)C)O)C)OC(=O)C)C)OC)C)O |
| InChi: | InChI=1S/C37H47N3O11/c1-15-11-10-12-16(2)36(47)40-28-27(39)26(38)23-24(32(28)45)31(44)20(6)34-25(23)35(46)37(8,51-34)49-14-13-22(48-9)17(3)33(50-21(7)41)19(5)30(43)18(4)29(15)42/h10-15,17-19,22,29-30,33,38,42-44H,39H2,1-9H3,(H,40,47)/b11-10+,14-13+,16-12-,38-26?/t15-,17+,18+,19+,22-,29-,30+,33+,37-/m0/s1 |
| InChiKey: | InChIKey=QIHXROBNYFPZNR-RAOJWDBNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.