* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(HYDROXYMETHYL)-5-METHYL-PYRROLO[2,1-F][1,2,4]TRIAZIN-4(1H)-ONE |
CAS: | 621685-54-9 |
English Synonyms: | 6-(HYDROXYMETHYL)-5-METHYL-PYRROLO[2,1-F][1,2,4]TRIAZIN-4(1H)-ONE |
MDL Number.: | MFCD12924537 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1c(cn2c1c(=O)nc[nH]2)CO |
InChi: | InChI=1S/C8H9N3O2/c1-5-6(3-12)2-11-7(5)8(13)9-4-10-11/h2,4,12H,3H2,1H3,(H,9,10,13) |
InChiKey: | InChIKey=XOXSCUFAOMGFMU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.