* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRENE-4,5-DIONE |
CAS: | 6217-22-7 |
English Synonyms: | PYRENE-4,5-QUINONE ; 4,5-PYRENEDIONE ; PYRENE-4,5-DIONE |
MDL Number.: | MFCD00089611 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc2ccc3cccc4c3c2c(c1)c(=O)c4=O |
InChi: | InChI=1S/C16H8O2/c17-15-11-5-1-3-9-7-8-10-4-2-6-12(16(15)18)14(10)13(9)11/h1-8H |
InChiKey: | InChIKey=JKCATVQPENLMQJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.