* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2(3H)-PYRIDONE, 6-METHOXY |
CAS: | 6231-15-8 |
English Synonyms: | 2(3H)-PYRIDONE, 6-METHOXY |
MDL Number.: | MFCD13175382 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | COC1=NC(=O)CC=C1 |
InChi: | InChI=1S/C6H7NO2/c1-9-6-4-2-3-5(8)7-6/h2,4H,3H2,1H3 |
InChiKey: | InChIKey=IGNIWPPQAFTEEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.