* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JYL-1511 |
| CAS: | 623166-14-3 |
| English Synonyms: | JYL-1511 |
| MDL Number.: | MFCD08702719 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CC(C)(C)c1ccc(cc1)CNC(=S)NCc2ccc(c(c2)OC)NS(=O)(=O)C |
| InChi: | InChI=1S/C21H29N3O3S2/c1-21(2,3)17-9-6-15(7-10-17)13-22-20(28)23-14-16-8-11-18(19(12-16)27-4)24-29(5,25)26/h6-12,24H,13-14H2,1-5H3,(H2,22,23,28) |
| InChiKey: | InChIKey=QGFPXWPVMTWSAE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.